C16H17NO3 — CID 104578704
1-hydroxy-N-(3-methoxycyclobutyl)naphthalene-2-carboxamide (PubChem CID 104578704) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-hydroxy-N-(3-methoxycyclobutyl)naphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-N-(3-methoxycyclobutyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 104578704 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-hydroxy-N-(3-methoxycyclobutyl)naphthalene-2-carboxamide |
| SMILES | COC1CC(NC(=O)c2ccc3ccccc3c2O)C1 |
| InChI | InChI=1S/C16H17NO3/c1-20-12-8-11(9-12)17-16(19)14-7-6-10-4-2-3-5-13(10)15(14)18/h2-7,11-12,18H,8-9H2,1H3,(H,17,19) |
| InChIKey | CJLVXNPGTYRWLZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |