C12H15NO3S — CID 107723796
2,5-dihydroxy-N-(thian-3-yl)benzamide (PubChem CID 107723796) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(thian-3-yl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(thian-3-yl)benzamide |
|---|---|
| PubChem CID | 107723796 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2,5-dihydroxy-N-(thian-3-yl)benzamide |
| SMILES | O=C(NC1CCCSC1)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H15NO3S/c14-9-3-4-11(15)10(6-9)12(16)13-8-2-1-5-17-7-8/h3-4,6,8,14-15H,1-2,5,7H2,(H,13,16) |
| InChIKey | BZXPUCOUUDZOEM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|