C11H14N2O3S2 — CID 39826173
4-sulfamoyl-N-[(3S)-thiolan-3-yl]benzamide (PubChem CID 39826173) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-sulfamoyl-N-[(3S)-thiolan-3-yl]benzamide.
| Compound Name | 4-sulfamoyl-N-[(3S)-thiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 39826173 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-sulfamoyl-N-[(3S)-thiolan-3-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N[C@H]2CCSC2)cc1 |
| InChI | InChI=1S/C11H14N2O3S2/c12-18(15,16)10-3-1-8(2-4-10)11(14)13-9-5-6-17-7-9/h1-4,9H,5-7H2,(H,13,14)(H2,12,15,16)/t9-/m0/s1 |
| InChIKey | QLZPNJYJXQYSFY-VIFPVBQESA-N |
| XLogP | 0.57 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |