C12H13F2NOS — CID 115605205
2,3-difluoro-N-(thian-4-yl)benzamide (PubChem CID 115605205) has the molecular formula C12H13F2NOS and a molecular weight of 257.30 g/mol. Its IUPAC name is 2,3-difluoro-N-(thian-4-yl)benzamide.
| Compound Name | 2,3-difluoro-N-(thian-4-yl)benzamide |
|---|---|
| PubChem CID | 115605205 |
| Molecular Formula | C12H13F2NOS |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2,3-difluoro-N-(thian-4-yl)benzamide |
| SMILES | O=C(NC1CCSCC1)c1cccc(F)c1F |
| InChI | InChI=1S/C12H13F2NOS/c13-10-3-1-2-9(11(10)14)12(16)15-8-4-6-17-7-5-8/h1-3,8H,4-7H2,(H,15,16) |
| InChIKey | CQIVYCXVAURZBF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |