C10H13N3OS — CID 103064661
4-amino-N-(thiolan-3-yl)pyridine-2-carboxamide (PubChem CID 103064661) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-amino-N-(thiolan-3-yl)pyridine-2-carboxamide.
| Compound Name | 4-amino-N-(thiolan-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103064661 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-amino-N-(thiolan-3-yl)pyridine-2-carboxamide |
| SMILES | Nc1ccnc(C(=O)NC2CCSC2)c1 |
| InChI | InChI=1S/C10H13N3OS/c11-7-1-3-12-9(5-7)10(14)13-8-2-4-15-6-8/h1,3,5,8H,2,4,6H2,(H2,11,12)(H,13,14) |
| InChIKey | NMIBGKLMXXPQNW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |