C7H9N3O2S — CID 126997753
N-(thiolan-3-yl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 126997753) has the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. Its IUPAC name is N-(thiolan-3-yl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-(thiolan-3-yl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 126997753 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | N-(thiolan-3-yl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | O=C(NC1CCSC1)c1cnon1 |
| InChI | InChI=1S/C7H9N3O2S/c11-7(6-3-8-12-10-6)9-5-1-2-13-4-5/h3,5H,1-2,4H2,(H,9,11) |
| InChIKey | MLTCWJGDRSPFKD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |