C9H11NO2S — CID 103708637
N-(thiolan-3-yl)furan-2-carboxamide (PubChem CID 103708637) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is N-(thiolan-3-yl)furan-2-carboxamide.
| Compound Name | N-(thiolan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103708637 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | N-(thiolan-3-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CCSC1)c1ccco1 |
| InChI | InChI=1S/C9H11NO2S/c11-9(8-2-1-4-12-8)10-7-3-5-13-6-7/h1-2,4,7H,3,5-6H2,(H,10,11) |
| InChIKey | BISHUSDLVJCBRR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |