C8H9NO4S — CID 130935311
N-(1,1-dioxothietan-3-yl)furan-2-carboxamide (PubChem CID 130935311) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is N-(1,1-dioxothietan-3-yl)furan-2-carboxamide.
| Compound Name | N-(1,1-dioxothietan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 130935311 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | N-(1,1-dioxothietan-3-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CS(=O)(=O)C1)c1ccco1 |
| InChI | InChI=1S/C8H9NO4S/c10-8(7-2-1-3-13-7)9-6-4-14(11,12)5-6/h1-3,6H,4-5H2,(H,9,10) |
| InChIKey | NVNUEXICPNENHX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |