C14H19N3O3 — CID 79873334
5-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzamide (PubChem CID 79873334) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzamide.
| Compound Name | 5-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 79873334 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 5-amino-N-(2,2-dimethylcyclopentyl)-2-nitrobenzamide |
| SMILES | CC1(C)CCCC1NC(=O)c1cc(N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O3/c1-14(2)7-3-4-12(14)16-13(18)10-8-9(15)5-6-11(10)17(19)20/h5-6,8,12H,3-4,7,15H2,1-2H3,(H,16,18) |
| InChIKey | HOIKWEBRKYDJHU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|