C16H22F2N2O — CID 79870125
N-(2,2-dimethylcyclohexyl)-3,5-difluoro-4-(methylamino)benzamide (PubChem CID 79870125) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-3,5-difluoro-4-(methylamino)benzamide.
| Compound Name | N-(2,2-dimethylcyclohexyl)-3,5-difluoro-4-(methylamino)benzamide |
|---|---|
| PubChem CID | 79870125 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-3,5-difluoro-4-(methylamino)benzamide |
| SMILES | CNc1c(F)cc(C(=O)NC2CCCCC2(C)C)cc1F |
| InChI | InChI=1S/C16H22F2N2O/c1-16(2)7-5-4-6-13(16)20-15(21)10-8-11(17)14(19-3)12(18)9-10/h8-9,13,19H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | IYEIJHLYZPRIMD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |