C15H20FNO2 — CID 79873059
4-[(2,2-dimethylcyclohexyl)amino]-3-fluorobenzoic acid (PubChem CID 79873059) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-[(2,2-dimethylcyclohexyl)amino]-3-fluorobenzoic acid.
| Compound Name | 4-[(2,2-dimethylcyclohexyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79873059 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-[(2,2-dimethylcyclohexyl)amino]-3-fluorobenzoic acid |
| SMILES | CC1(C)CCCCC1Nc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C15H20FNO2/c1-15(2)8-4-3-5-13(15)17-12-7-6-10(14(18)19)9-11(12)16/h6-7,9,13,17H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | CIZUAWTUFZKKIM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |