methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate

C15H20FNO2 — CID 79860460

IUPACmethyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)c(NC2CCCC2(C)C)c1
InChIInChI=1S/C15H20FNO2/c1-15(2)8-4-5-13(15)17-12-9-10(14(18)19-3)6-7-11(12)16/h6-7,9,13,17H,4-5,8H2,1-3H3
InChIKeyROAMOFNCOKZMLE-UHFFFAOYSA-N
MW265.33 g/mol
LogP3.60
Rot. Bonds3

About methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate

methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate (PubChem CID 79860460) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate.

Molecular Properties

Compound Namemethyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate
PubChem CID79860460
Molecular FormulaC15H20FNO2
Molecular Weight265.33 g/mol
Exact Mass265.15
IUPAC Namemethyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)c(NC2CCCC2(C)C)c1
InChIInChI=1S/C15H20FNO2/c1-15(2)8-4-5-13(15)17-12-9-10(14(18)19-3)6-7-11(12)16/h6-7,9,13,17H,4-5,8H2,1-3H3
InChIKeyROAMOFNCOKZMLE-UHFFFAOYSA-N
XLogP3.60
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.33
LogP ≤ 53.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate?
The IUPAC name of methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate (CID 79860460) is methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate.
What is the SMILES notation for methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate?
The canonical SMILES for methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate is COC(=O)c1ccc(F)c(NC2CCCC2(C)C)c1.
What is the InChIKey of methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate?
The InChIKey is ROAMOFNCOKZMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c1-15(2)8-4-5-13(15)17-12-9-10(14(18)19-3)6-7-11(12)16/h6-7,9,13,17H,4-5,8H2,1-3H3.
What are the key properties of methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate?
methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate has a molecular weight of 265.33 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,2-dimethylcyclopentyl)amino]-4-fluorobenzoate is sourced from PubChem (CID 79860460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).