methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate

C14H19FN2O2 — CID 81466913

IUPACmethyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)c(NC2CC(C)N(C)C2)c1
InChIInChI=1S/C14H19FN2O2/c1-9-6-11(8-17(9)2)16-13-7-10(14(18)19-3)4-5-12(13)15/h4-5,7,9,11,16H,6,8H2,1-3H3
InChIKeyAUTZXHQOVMDWRB-UHFFFAOYSA-N
MW266.32 g/mol
LogP2.12
Rot. Bonds3

About methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate

methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate (PubChem CID 81466913) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate.

Molecular Properties

Compound Namemethyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate
PubChem CID81466913
Molecular FormulaC14H19FN2O2
Molecular Weight266.32 g/mol
Exact Mass266.14
IUPAC Namemethyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate
SMILESCOC(=O)c1ccc(F)c(NC2CC(C)N(C)C2)c1
InChIInChI=1S/C14H19FN2O2/c1-9-6-11(8-17(9)2)16-13-7-10(14(18)19-3)4-5-12(13)15/h4-5,7,9,11,16H,6,8H2,1-3H3
InChIKeyAUTZXHQOVMDWRB-UHFFFAOYSA-N
XLogP2.12
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.32
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate?
The IUPAC name of methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate (CID 81466913) is methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate.
What is the SMILES notation for methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate?
The canonical SMILES for methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate is COC(=O)c1ccc(F)c(NC2CC(C)N(C)C2)c1.
What is the InChIKey of methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate?
The InChIKey is AUTZXHQOVMDWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O2/c1-9-6-11(8-17(9)2)16-13-7-10(14(18)19-3)4-5-12(13)15/h4-5,7,9,11,16H,6,8H2,1-3H3.
What are the key properties of methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate?
methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate has a molecular weight of 266.32 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1,5-dimethylpyrrolidin-3-yl)amino]-4-fluorobenzoate is sourced from PubChem (CID 81466913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).