C15H20FNO2S — CID 79947760
methyl 3-[(4,4-dimethylthian-3-yl)amino]-4-fluorobenzoate (PubChem CID 79947760) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is methyl 3-[(4,4-dimethylthian-3-yl)amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[(4,4-dimethylthian-3-yl)amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 79947760 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 3-[(4,4-dimethylthian-3-yl)amino]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(NC2CSCCC2(C)C)c1 |
| InChI | InChI=1S/C15H20FNO2S/c1-15(2)6-7-20-9-13(15)17-12-8-10(14(18)19-3)4-5-11(12)16/h4-5,8,13,17H,6-7,9H2,1-3H3 |
| InChIKey | FCWOPYLGILNVSL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |