C15H21F2NO2S — CID 79954810
N-[2-(difluoromethoxy)-5-methoxyphenyl]-4,4-dimethylthian-3-amine (PubChem CID 79954810) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methoxyphenyl]-4,4-dimethylthian-3-amine.
| Compound Name | N-[2-(difluoromethoxy)-5-methoxyphenyl]-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79954810 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methoxyphenyl]-4,4-dimethylthian-3-amine |
| SMILES | COc1ccc(OC(F)F)c(NC2CSCCC2(C)C)c1 |
| InChI | InChI=1S/C15H21F2NO2S/c1-15(2)6-7-21-9-13(15)18-11-8-10(19-3)4-5-12(11)20-14(16)17/h4-5,8,13-14,18H,6-7,9H2,1-3H3 |
| InChIKey | WDIAOXWFSBPWFY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |