C13H17F2NO4S — CID 63909309
N-[2-(difluoromethoxy)-5-methoxyphenyl]-1,1-dioxothian-3-amine (PubChem CID 63909309) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methoxyphenyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[2-(difluoromethoxy)-5-methoxyphenyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63909309 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methoxyphenyl]-1,1-dioxothian-3-amine |
| SMILES | COc1ccc(OC(F)F)c(NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17F2NO4S/c1-19-10-4-5-12(20-13(14)15)11(7-10)16-9-3-2-6-21(17,18)8-9/h4-5,7,9,13,16H,2-3,6,8H2,1H3 |
| InChIKey | HFYLVCYJTZYLIZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |