C13H16N2O3S2 — CID 79519118
N-(1,1-dioxothian-3-yl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 79519118) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79519118 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(NC3CCCS(=O)(=O)C3)sc2c1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-18-10-4-5-11-12(7-10)19-13(15-11)14-9-3-2-6-20(16,17)8-9/h4-5,7,9H,2-3,6,8H2,1H3,(H,14,15) |
| InChIKey | QOFAQJVUXQYEHN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |