C11H11BrN2O2S2 — CID 79534163
6-bromo-N-(1,1-dioxothiolan-3-yl)-1,3-benzothiazol-2-amine (PubChem CID 79534163) has the molecular formula C11H11BrN2O2S2 and a molecular weight of 347.26 g/mol. Its IUPAC name is 6-bromo-N-(1,1-dioxothiolan-3-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(1,1-dioxothiolan-3-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79534163 |
| Molecular Formula | C11H11BrN2O2S2 |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 345.94 |
| IUPAC Name | 6-bromo-N-(1,1-dioxothiolan-3-yl)-1,3-benzothiazol-2-amine |
| SMILES | O=S1(=O)CCC(Nc2nc3ccc(Br)cc3s2)C1 |
| InChI | InChI=1S/C11H11BrN2O2S2/c12-7-1-2-9-10(5-7)17-11(14-9)13-8-3-4-18(15,16)6-8/h1-2,5,8H,3-4,6H2,(H,13,14) |
| InChIKey | RQDICLRABVPFGR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |