C16H13BrN2S — CID 107853185
6-bromo-N-(2,3-dihydro-1H-inden-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 107853185) has the molecular formula C16H13BrN2S and a molecular weight of 345.27 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dihydro-1H-inden-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(2,3-dihydro-1H-inden-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107853185 |
| Molecular Formula | C16H13BrN2S |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 6-bromo-N-(2,3-dihydro-1H-inden-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Brc1ccc2nc(NC3Cc4ccccc4C3)sc2c1 |
| InChI | InChI=1S/C16H13BrN2S/c17-12-5-6-14-15(9-12)20-16(19-14)18-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13H,7-8H2,(H,18,19) |
| InChIKey | MDWJMLVAXAGVET-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |