C9H9BrN2OS — CID 163760821
1-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethanol (PubChem CID 163760821) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethanol.
| Compound Name | 1-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 163760821 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 1-[(6-bromo-1,3-benzothiazol-2-yl)amino]ethanol |
| SMILES | CC(O)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C9H9BrN2OS/c1-5(13)11-9-12-7-3-2-6(10)4-8(7)14-9/h2-5,13H,1H3,(H,11,12) |
| InChIKey | LXZZUANNEUPCAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|