C10H11BrN2S — CID 43306435
5-bromo-N-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 43306435) has the molecular formula C10H11BrN2S and a molecular weight of 271.18 g/mol. Its IUPAC name is 5-bromo-N-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 5-bromo-N-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43306435 |
| Molecular Formula | C10H11BrN2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 5-bromo-N-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CC(C)Nc1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C10H11BrN2S/c1-6(2)12-10-13-8-5-7(11)3-4-9(8)14-10/h3-6H,1-2H3,(H,12,13) |
| InChIKey | KTEMRPIVEVYSML-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |