C13H6BrCl3N2S — CID 63546956
5-bromo-N-(2,4,5-trichlorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 63546956) has the molecular formula C13H6BrCl3N2S and a molecular weight of 408.54 g/mol. Its IUPAC name is 5-bromo-N-(2,4,5-trichlorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-bromo-N-(2,4,5-trichlorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 63546956 |
| Molecular Formula | C13H6BrCl3N2S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 405.85 |
| IUPAC Name | 5-bromo-N-(2,4,5-trichlorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1cc(Cl)c(Nc2nc3cc(Br)ccc3s2)cc1Cl |
| InChI | InChI=1S/C13H6BrCl3N2S/c14-6-1-2-12-11(3-6)19-13(20-12)18-10-5-8(16)7(15)4-9(10)17/h1-5H,(H,18,19) |
| InChIKey | XWIICFISEUSVOG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|