C13H7Cl3N2S — CID 43306502
5-chloro-N-(2,5-dichlorophenyl)-1,3-benzothiazol-2-amine (PubChem CID 43306502) has the molecular formula C13H7Cl3N2S and a molecular weight of 329.64 g/mol. Its IUPAC name is 5-chloro-N-(2,5-dichlorophenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-chloro-N-(2,5-dichlorophenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43306502 |
| Molecular Formula | C13H7Cl3N2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 5-chloro-N-(2,5-dichlorophenyl)-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(Cl)c(Nc2nc3cc(Cl)ccc3s2)c1 |
| InChI | InChI=1S/C13H7Cl3N2S/c14-7-1-3-9(16)10(5-7)17-13-18-11-6-8(15)2-4-12(11)19-13/h1-6H,(H,17,18) |
| InChIKey | CUSAIVNWMZBVQA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |