C13H17BrN2S — CID 79527747
6-bromo-N-(4-methylpentyl)-1,3-benzothiazol-2-amine (PubChem CID 79527747) has the molecular formula C13H17BrN2S and a molecular weight of 313.26 g/mol. Its IUPAC name is 6-bromo-N-(4-methylpentyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-(4-methylpentyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79527747 |
| Molecular Formula | C13H17BrN2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 6-bromo-N-(4-methylpentyl)-1,3-benzothiazol-2-amine |
| SMILES | CC(C)CCCNc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C13H17BrN2S/c1-9(2)4-3-7-15-13-16-11-6-5-10(14)8-12(11)17-13/h5-6,8-9H,3-4,7H2,1-2H3,(H,15,16) |
| InChIKey | QCOHSVOGBILHGQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|