C14H18N2O3S2 — CID 79516069
N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3-benzothiazol-2-amine (PubChem CID 79516069) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79516069 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-6-ethoxy-1,3-benzothiazol-2-amine |
| SMILES | CCOc1ccc2nc(NC3CCS(=O)(=O)CC3)sc2c1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-2-19-11-3-4-12-13(9-11)20-14(16-12)15-10-5-7-21(17,18)8-6-10/h3-4,9-10H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | KUCQTQBFZQBIEL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |