C10H12F2N2O3S — CID 133424242
5-(difluoromethoxy)-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine (PubChem CID 133424242) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(difluoromethoxy)-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine.
| Compound Name | 5-(difluoromethoxy)-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 133424242 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-(difluoromethoxy)-N-(1,1-dioxothiolan-3-yl)pyridin-2-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc(OC(F)F)cn2)C1 |
| InChI | InChI=1S/C10H12F2N2O3S/c11-10(12)17-8-1-2-9(13-5-8)14-7-3-4-18(15,16)6-7/h1-2,5,7,10H,3-4,6H2,(H,13,14) |
| InChIKey | CDVONHWABRRTSD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |