C16H16F2N4O2 — CID 97138669
[(3S)-3-[[5-(difluoromethoxy)-2-pyridinyl]amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 97138669) has the molecular formula C16H16F2N4O2 and a molecular weight of 334.33 g/mol. Its IUPAC name is [(3S)-3-[[5-(difluoromethoxy)-2-pyridinyl]amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-3-[[5-(difluoromethoxy)-2-pyridinyl]amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 97138669 |
| Molecular Formula | C16H16F2N4O2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(3S)-3-[[5-(difluoromethoxy)-2-pyridinyl]amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CC[C@H](Nc2ccc(OC(F)F)cn2)C1 |
| InChI | InChI=1S/C16H16F2N4O2/c17-16(18)24-12-4-5-14(20-9-12)21-11-6-8-22(10-11)15(23)13-3-1-2-7-19-13/h1-5,7,9,11,16H,6,8,10H2,(H,20,21)/t11-/m0/s1 |
| InChIKey | YECGIFDAZYCPOA-NSHDSACASA-N |
| XLogP | 2.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |