C16H17N3O2S — CID 97237121
4-methyl-N-[(3R)-1-(pyridine-2-carbonyl)pyrrolidin-3-yl]thiophene-3-carboxamide (PubChem CID 97237121) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-methyl-N-[(3R)-1-(pyridine-2-carbonyl)pyrrolidin-3-yl]thiophene-3-carboxamide.
| Compound Name | 4-methyl-N-[(3R)-1-(pyridine-2-carbonyl)pyrrolidin-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97237121 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-methyl-N-[(3R)-1-(pyridine-2-carbonyl)pyrrolidin-3-yl]thiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)N[C@@H]1CCN(C(=O)c2ccccn2)C1 |
| InChI | InChI=1S/C16H17N3O2S/c1-11-9-22-10-13(11)15(20)18-12-5-7-19(8-12)16(21)14-4-2-3-6-17-14/h2-4,6,9-10,12H,5,7-8H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | TYNYHRZCMFTCQF-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |