C17H16F3N3O3S — CID 113013624
N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]-4-(trifluoromethyl)benzamide (PubChem CID 113013624) has the molecular formula C17H16F3N3O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113013624 |
| Molecular Formula | C17H16F3N3O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(NC2CCS(=O)(=O)C2)nc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3N3O3S/c18-17(19,20)12-3-1-11(2-4-12)16(24)23-13-5-6-15(21-9-13)22-14-7-8-27(25,26)10-14/h1-6,9,14H,7-8,10H2,(H,21,22)(H,23,24) |
| InChIKey | KOWPGTSEOQNJNH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |