C12H13BrClF2NO3S — CID 63911658
N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-1,1-dioxothian-3-amine (PubChem CID 63911658) has the molecular formula C12H13BrClF2NO3S and a molecular weight of 404.66 g/mol. Its IUPAC name is N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-1,1-dioxothian-3-amine.
| Compound Name | N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63911658 |
| Molecular Formula | C12H13BrClF2NO3S |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 402.95 |
| IUPAC Name | N-[3-bromo-5-chloro-2-(difluoromethoxy)phenyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(Nc2cc(Cl)cc(Br)c2OC(F)F)C1 |
| InChI | InChI=1S/C12H13BrClF2NO3S/c13-9-4-7(14)5-10(11(9)20-12(15)16)17-8-2-1-3-21(18,19)6-8/h4-5,8,12,17H,1-3,6H2 |
| InChIKey | XFJDTUMKJWVLCI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |