C14H20N2O5S — CID 56795391
1-(2,5-dimethoxyphenyl)-3-(1,1-dioxothian-3-yl)urea (PubChem CID 56795391) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(1,1-dioxothian-3-yl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(1,1-dioxothian-3-yl)urea |
|---|---|
| PubChem CID | 56795391 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(1,1-dioxothian-3-yl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H20N2O5S/c1-20-11-5-6-13(21-2)12(8-11)16-14(17)15-10-4-3-7-22(18,19)9-10/h5-6,8,10H,3-4,7,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | POWWKKFJPDLNDS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |