C17H24FNO2 — CID 65084484
methyl 3-[(4-ethylcycloheptyl)amino]-4-fluorobenzoate (PubChem CID 65084484) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is methyl 3-[(4-ethylcycloheptyl)amino]-4-fluorobenzoate.
| Compound Name | methyl 3-[(4-ethylcycloheptyl)amino]-4-fluorobenzoate |
|---|---|
| PubChem CID | 65084484 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | methyl 3-[(4-ethylcycloheptyl)amino]-4-fluorobenzoate |
| SMILES | CCC1CCCC(Nc2cc(C(=O)OC)ccc2F)CC1 |
| InChI | InChI=1S/C17H24FNO2/c1-3-12-5-4-6-14(9-7-12)19-16-11-13(17(20)21-2)8-10-15(16)18/h8,10-12,14,19H,3-7,9H2,1-2H3 |
| InChIKey | ATMKZFOUZSVRAK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |