C12H15BrF2N2 — CID 102852892
N-(5-bromo-2,4-difluorophenyl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 102852892) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 102852892 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2cc(Br)c(F)cc2F)CN1C |
| InChI | InChI=1S/C12H15BrF2N2/c1-7-3-8(6-17(7)2)16-12-4-9(13)10(14)5-11(12)15/h4-5,7-8,16H,3,6H2,1-2H3 |
| InChIKey | ANCNKOQNSYPGBC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|