About 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline
5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline (PubChem CID 102852647) has the molecular formula C13H16BrF2NO
and a molecular weight of 320.18 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline |
| PubChem CID | 102852647 |
| Molecular Formula | C13H16BrF2NO |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline |
| SMILES | COC1CCC(Nc2cc(Br)c(F)cc2F)CC1 |
| InChI | InChI=1S/C13H16BrF2NO/c1-18-9-4-2-8(3-5-9)17-13-6-10(14)11(15)7-12(13)16/h6-9,17H,2-5H2,1H3 |
| InChIKey | NLMZBEFHQQAJOW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline?
The IUPAC name of 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline (CID 102852647) is 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline.
What is the SMILES notation for 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline?
The canonical SMILES for 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline is COC1CCC(Nc2cc(Br)c(F)cc2F)CC1.
What is the InChIKey of 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline?
The InChIKey is NLMZBEFHQQAJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrF2NO/c1-18-9-4-2-8(3-5-9)17-13-6-10(14)11(15)7-12(13)16/h6-9,17H,2-5H2,1H3.
What are the key properties of 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline?
5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline has a molecular weight of 320.18 g/mol, XLogP of 4.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-difluoro-N-(4-methoxycyclohexyl)aniline is sourced from PubChem (CID 102852647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).