C16H20N4O2 — CID 95760441
1-[(1S,2S)-2-imidazol-1-ylcyclopentyl]-3-(4-methoxyphenyl)urea (PubChem CID 95760441) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[(1S,2S)-2-imidazol-1-ylcyclopentyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(1S,2S)-2-imidazol-1-ylcyclopentyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 95760441 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[(1S,2S)-2-imidazol-1-ylcyclopentyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2CCC[C@@H]2n2ccnc2)cc1 |
| InChI | InChI=1S/C16H20N4O2/c1-22-13-7-5-12(6-8-13)18-16(21)19-14-3-2-4-15(14)20-10-9-17-11-20/h5-11,14-15H,2-4H2,1H3,(H2,18,19,21)/t14-,15-/m0/s1 |
| InChIKey | RTGSTIDKYXYQKJ-GJZGRUSLSA-N |
| XLogP | 2.81 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |