C26H30N2OS — CID 143964023
(2E,4E,6E,8E)-N-(3-cyanophenyl)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)nona-2,4,6,8-tetraenamide (PubChem CID 143964023) has the molecular formula C26H30N2OS and a molecular weight of 418.61 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(3-cyanophenyl)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(3-cyanophenyl)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 143964023 |
| Molecular Formula | C26H30N2OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (2E,4E,6E,8E)-N-(3-cyanophenyl)-3,7-dimethyl-9-(4,4,6-trimethyl-2,3-dihydrothiopyran-5-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cccc(C#N)c2)C(C)(C)CCS1 |
| InChI | InChI=1S/C26H30N2OS/c1-19(12-13-24-21(3)30-15-14-26(24,4)5)8-6-9-20(2)16-25(29)28-23-11-7-10-22(17-23)18-27/h6-13,16-17H,14-15H2,1-5H3,(H,28,29)/b9-6+,13-12+,19-8+,20-16+ |
| InChIKey | SRAUBLIZBPSCSV-AEJJRYNXSA-N |
| XLogP | 6.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|