C25H36N2O2 — CID 145086458
ethane;methyl (2Z,4E,6E,8E)-9-(3-imidazol-1-yl-2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 145086458) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is ethane;methyl (2Z,4E,6E,8E)-9-(3-imidazol-1-yl-2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | ethane;methyl (2Z,4E,6E,8E)-9-(3-imidazol-1-yl-2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 145086458 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | ethane;methyl (2Z,4E,6E,8E)-9-(3-imidazol-1-yl-2,6-dimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CC.COC(=O)/C=C(C)\C=C\C=C(C)\C=C\C1=C(C)C(n2ccnc2)CCC1C |
| InChI | InChI=1S/C23H30N2O2.C2H6/c1-17(7-6-8-18(2)15-23(26)27-5)9-11-21-19(3)10-12-22(20(21)4)25-14-13-24-16-25;1-2/h6-9,11,13-16,19,22H,10,12H2,1-5H3;1-2H3/b8-6+,11-9+,17-7+,18-15-; |
| InChIKey | IPGXFRGULBLPDU-FVGNZADNSA-N |
| XLogP | 6.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|