C21H33NO — CID 86576396
N-[(2S,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]formamide (PubChem CID 86576396) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is N-[(2S,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]formamide.
| Compound Name | N-[(2S,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]formamide |
|---|---|
| PubChem CID | 86576396 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | N-[(2S,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]formamide |
| SMILES | C=C(C)/C=C/[C@]12C[C@H](C)C3CC[C@](C)(NC=O)[C@@H](CC[C@H]1C)[C@@H]32 |
| InChI | InChI=1S/C21H33NO/c1-14(2)8-11-21-12-15(3)17-9-10-20(5,22-13-23)18(19(17)21)7-6-16(21)4/h8,11,13,15-19H,1,6-7,9-10,12H2,2-5H3,(H,22,23)/b11-8+/t15-,16+,17?,18-,19+,20-,21-/m0/s1 |
| InChIKey | LRROLTVIMJUAAP-DITHMWACSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|