C6H10N2O2 — CID 174912967
N-(2-formamido-2-methylcyclopropyl)formamide (PubChem CID 174912967) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is N-(2-formamido-2-methylcyclopropyl)formamide.
| Compound Name | N-(2-formamido-2-methylcyclopropyl)formamide |
|---|---|
| PubChem CID | 174912967 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N-(2-formamido-2-methylcyclopropyl)formamide |
| SMILES | CC1(NC=O)CC1NC=O |
| InChI | InChI=1S/C6H10N2O2/c1-6(8-4-10)2-5(6)7-3-9/h3-5H,2H2,1H3,(H,7,9)(H,8,10) |
| InChIKey | FGMONQNADOOIBO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|