C14H25NO2 — CID 163546696
(4S,7S,8S)-4,7,8-trimethyl-4-(methylideneamino)-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2,3-diol (PubChem CID 163546696) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (4S,7S,8S)-4,7,8-trimethyl-4-(methylideneamino)-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2,3-diol.
| Compound Name | (4S,7S,8S)-4,7,8-trimethyl-4-(methylideneamino)-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2,3-diol |
|---|---|
| PubChem CID | 163546696 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (4S,7S,8S)-4,7,8-trimethyl-4-(methylideneamino)-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalene-2,3-diol |
| SMILES | C=N[C@]1(C)C(O)C(O)CC2C1CC[C@H](C)[C@@H]2C |
| InChI | InChI=1S/C14H25NO2/c1-8-5-6-11-10(9(8)2)7-12(16)13(17)14(11,3)15-4/h8-13,16-17H,4-7H2,1-3H3/t8-,9-,10?,11?,12?,13?,14-/m0/s1 |
| InChIKey | FFPSVWUBBPUMCY-WVEDIGMRSA-N |
| XLogP | 1.87 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|