C14H22O — CID 71328199
3,6,8,8-tetramethyl-1,2,3,3a,7,8a-hexahydroazulen-4-one (PubChem CID 71328199) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,6,8,8-tetramethyl-1,2,3,3a,7,8a-hexahydroazulen-4-one.
| Compound Name | 3,6,8,8-tetramethyl-1,2,3,3a,7,8a-hexahydroazulen-4-one |
|---|---|
| PubChem CID | 71328199 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 3,6,8,8-tetramethyl-1,2,3,3a,7,8a-hexahydroazulen-4-one |
| SMILES | CC1=CC(=O)C2C(C)CCC2C(C)(C)C1 |
| InChI | InChI=1S/C14H22O/c1-9-7-12(15)13-10(2)5-6-11(13)14(3,4)8-9/h7,10-11,13H,5-6,8H2,1-4H3 |
| InChIKey | WZEJGWVFBAQFFI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |