C15H22O3 — CID 45273078
(1R,2S,3S,5Z,9S)-3-hydroxy-6,10,10-trimethylspiro[bicyclo[7.2.0]undec-5-ene-2,2'-oxirane]-4-one (PubChem CID 45273078) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2S,3S,5Z,9S)-3-hydroxy-6,10,10-trimethylspiro[bicyclo[7.2.0]undec-5-ene-2,2'-oxirane]-4-one.
| Compound Name | (1R,2S,3S,5Z,9S)-3-hydroxy-6,10,10-trimethylspiro[bicyclo[7.2.0]undec-5-ene-2,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 45273078 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2S,3S,5Z,9S)-3-hydroxy-6,10,10-trimethylspiro[bicyclo[7.2.0]undec-5-ene-2,2'-oxirane]-4-one |
| SMILES | C/C1=C/C(=O)[C@@H](O)[C@@]2(CO2)[C@@H]2CC(C)(C)[C@H]2CC1 |
| InChI | InChI=1S/C15H22O3/c1-9-4-5-10-11(7-14(10,2)3)15(8-18-15)13(17)12(16)6-9/h6,10-11,13,17H,4-5,7-8H2,1-3H3/b9-6-/t10-,11+,13+,15+/m0/s1 |
| InChIKey | FENYMDPUPDDJBK-SCOAVTSJSA-N |
| XLogP | 2.09 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|