C16H20O — CID 14710923
(1R,3aS,9aS)-1,4,4-trimethyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one (PubChem CID 14710923) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (1R,3aS,9aS)-1,4,4-trimethyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one.
| Compound Name | (1R,3aS,9aS)-1,4,4-trimethyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one |
|---|---|
| PubChem CID | 14710923 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1R,3aS,9aS)-1,4,4-trimethyl-2,3,3a,9a-tetrahydro-1H-cyclopenta[b]naphthalen-9-one |
| SMILES | C[C@@H]1CC[C@H]2[C@H]1C(=O)c1ccccc1C2(C)C |
| InChI | InChI=1S/C16H20O/c1-10-8-9-13-14(10)15(17)11-6-4-5-7-12(11)16(13,2)3/h4-7,10,13-14H,8-9H2,1-3H3/t10-,13+,14+/m1/s1 |
| InChIKey | IXNSIKHRMSLJKV-SWHYSGLUSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |