C24H22O2 — CID 10268957
4-hydroxy-2,3-dimethyl-3,4-diphenyl-2H-naphthalen-1-one (PubChem CID 10268957) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethyl-3,4-diphenyl-2H-naphthalen-1-one.
| Compound Name | 4-hydroxy-2,3-dimethyl-3,4-diphenyl-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 10268957 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-hydroxy-2,3-dimethyl-3,4-diphenyl-2H-naphthalen-1-one |
| SMILES | CC1C(=O)c2ccccc2C(O)(c2ccccc2)C1(C)c1ccccc1 |
| InChI | InChI=1S/C24H22O2/c1-17-22(25)20-15-9-10-16-21(20)24(26,19-13-7-4-8-14-19)23(17,2)18-11-5-3-6-12-18/h3-17,26H,1-2H3 |
| InChIKey | REBAEHWXQPBLEM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |