C31H26O4 — CID 93012418
(1S,2S,3R,3aR,8bS)-1,8b-dihydroxy-3-(4-methoxyphenyl)-1,2-diphenyl-3,3a-dihydro-2H-cyclopenta[a]inden-4-one (PubChem CID 93012418) has the molecular formula C31H26O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is (1S,2S,3R,3aR,8bS)-1,8b-dihydroxy-3-(4-methoxyphenyl)-1,2-diphenyl-3,3a-dihydro-2H-cyclopenta[a]inden-4-one.
| Compound Name | (1S,2S,3R,3aR,8bS)-1,8b-dihydroxy-3-(4-methoxyphenyl)-1,2-diphenyl-3,3a-dihydro-2H-cyclopenta[a]inden-4-one |
|---|---|
| PubChem CID | 93012418 |
| Molecular Formula | C31H26O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (1S,2S,3R,3aR,8bS)-1,8b-dihydroxy-3-(4-methoxyphenyl)-1,2-diphenyl-3,3a-dihydro-2H-cyclopenta[a]inden-4-one |
| SMILES | COc1ccc([C@H]2[C@H]3C(=O)c4ccccc4[C@]3(O)[C@@](O)(c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26O4/c1-35-23-18-16-20(17-19-23)26-27(21-10-4-2-5-11-21)30(33,22-12-6-3-7-13-22)31(34)25-15-9-8-14-24(25)29(32)28(26)31/h2-19,26-28,33-34H,1H3/t26-,27-,28+,30-,31-/m1/s1 |
| InChIKey | MHKQZXSVQZIDFQ-UWLRILINSA-N |
| XLogP | 5.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |