C18H18O — CID 125117217
(3R,4R)-3,4-dimethyl-4-phenyl-2,3-dihydronaphthalen-1-one (PubChem CID 125117217) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethyl-4-phenyl-2,3-dihydronaphthalen-1-one.
| Compound Name | (3R,4R)-3,4-dimethyl-4-phenyl-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 125117217 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3R,4R)-3,4-dimethyl-4-phenyl-2,3-dihydronaphthalen-1-one |
| SMILES | C[C@@H]1CC(=O)c2ccccc2[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-13-12-17(19)15-10-6-7-11-16(15)18(13,2)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3/t13-,18-/m1/s1 |
| InChIKey | RMCVJQZHRUAYMH-FZKQIMNGSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |