C16H14O2 — CID 156789508
(2R,3R)-3-hydroxy-2-methyl-2-phenyl-3H-inden-1-one (PubChem CID 156789508) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2-methyl-2-phenyl-3H-inden-1-one.
| Compound Name | (2R,3R)-3-hydroxy-2-methyl-2-phenyl-3H-inden-1-one |
|---|---|
| PubChem CID | 156789508 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2R,3R)-3-hydroxy-2-methyl-2-phenyl-3H-inden-1-one |
| SMILES | C[C@]1(c2ccccc2)C(=O)c2ccccc2[C@H]1O |
| InChI | InChI=1S/C16H14O2/c1-16(11-7-3-2-4-8-11)14(17)12-9-5-6-10-13(12)15(16)18/h2-10,14,17H,1H3/t14-,16-/m1/s1 |
| InChIKey | PIWCCDHTKCFFRO-GDBMZVCRSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |