C18H17NO3 — CID 101416255
(3S,4R)-2,3-dimethyl-1-oxo-3-phenyl-4H-isoquinoline-4-carboxylic acid (PubChem CID 101416255) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (3S,4R)-2,3-dimethyl-1-oxo-3-phenyl-4H-isoquinoline-4-carboxylic acid.
| Compound Name | (3S,4R)-2,3-dimethyl-1-oxo-3-phenyl-4H-isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 101416255 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (3S,4R)-2,3-dimethyl-1-oxo-3-phenyl-4H-isoquinoline-4-carboxylic acid |
| SMILES | CN1C(=O)c2ccccc2[C@@H](C(=O)O)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-18(12-8-4-3-5-9-12)15(17(21)22)13-10-6-7-11-14(13)16(20)19(18)2/h3-11,15H,1-2H3,(H,21,22)/t15-,18+/m0/s1 |
| InChIKey | VUJZPEXWHGWREB-MAUKXSAKSA-N |
| XLogP | 2.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |