About 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid
2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid (PubChem CID 110457653) has the molecular formula C18H22N2O3
and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid |
| PubChem CID | 110457653 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid |
| SMILES | CN1CCC2(CC1)C(C(=O)O)c1ccccc1C(=O)N2C1CC1 |
| InChI | InChI=1S/C18H22N2O3/c1-19-10-8-18(9-11-19)15(17(22)23)13-4-2-3-5-14(13)16(21)20(18)12-6-7-12/h2-5,12,15H,6-11H2,1H3,(H,22,23) |
| InChIKey | QVCFZNYBWMWVHH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid?
The IUPAC name of 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid (CID 110457653) is 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid.
What is the SMILES notation for 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid?
The canonical SMILES for 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid is CN1CCC2(CC1)C(C(=O)O)c1ccccc1C(=O)N2C1CC1.
What is the InChIKey of 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid?
The InChIKey is QVCFZNYBWMWVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3/c1-19-10-8-18(9-11-19)15(17(22)23)13-4-2-3-5-14(13)16(21)20(18)12-6-7-12/h2-5,12,15H,6-11H2,1H3,(H,22,23).
What are the key properties of 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid?
2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid has a molecular weight of 314.38 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1'-methyl-1-oxospiro[4H-isoquinoline-3,4'-piperidine]-4-carboxylic acid is sourced from PubChem (CID 110457653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).