About 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid
2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 82579599) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
Analyze 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid?
The IUPAC name of 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (CID 82579599) is 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
What is the SMILES notation for 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid?
The canonical SMILES for 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid is CC1C(C(=O)O)c2ccccc2C(=O)N1C.
What is the InChIKey of 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid?
The InChIKey is IXIOSQUUMVQEKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-7-10(12(15)16)8-5-3-4-6-9(8)11(14)13(7)2/h3-7,10H,1-2H3,(H,15,16).
What are the key properties of 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid?
2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid is sourced from PubChem (CID 82579599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).